C34H43FN4O5S — CID 143613192
ethane;ethyl 3-[4-[2-[(4-aminophenyl)sulfonylamino]ethoxy]phenyl]-2-cyanopropanoate;3-[(3-fluorophenyl)methyl]-3-azabicyclo[3.1.0]hexane (PubChem CID 143613192) has the molecular formula C34H43FN4O5S and a molecular weight of 638.81 g/mol. Its IUPAC name is ethane;ethyl 3-[4-[2-[(4-aminophenyl)sulfonylamino]ethoxy]phenyl]-2-cyanopropanoate;3-[(3-fluorophenyl)methyl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | ethane;ethyl 3-[4-[2-[(4-aminophenyl)sulfonylamino]ethoxy]phenyl]-2-cyanopropanoate;3-[(3-fluorophenyl)methyl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143613192 |
| Molecular Formula | C34H43FN4O5S |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.29 |
| IUPAC Name | ethane;ethyl 3-[4-[2-[(4-aminophenyl)sulfonylamino]ethoxy]phenyl]-2-cyanopropanoate;3-[(3-fluorophenyl)methyl]-3-azabicyclo[3.1.0]hexane |
| SMILES | CC.CCOC(=O)C(C#N)Cc1ccc(OCCNS(=O)(=O)c2ccc(N)cc2)cc1.Fc1cccc(CN2CC3CC3C2)c1 |
| InChI | InChI=1S/C20H23N3O5S.C12H14FN.C2H6/c1-2-27-20(24)16(14-21)13-15-3-7-18(8-4-15)28-12-11-23-29(25,26)19-9-5-17(22)6-10-19;13-12-3-1-2-9(4-12)6-14-7-10-5-11(10)8-14;1-2/h3-10,16,23H,2,11-13,22H2,1H3;1-4,10-11H,5-8H2;1-2H3 |
| InChIKey | OSJZLNABVAFOAW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|