C39H33N7 — CID 143633863
N'-[amino-(6-pyridin-2-yl-2-pyridinyl)methyl]-6-pyridin-2-ylpyridine-2-carboximidamide;2-(4-methylphenyl)naphthalene (PubChem CID 143633863) has the molecular formula C39H33N7 and a molecular weight of 599.74 g/mol. Its IUPAC name is N'-[amino-(6-pyridin-2-yl-2-pyridinyl)methyl]-6-pyridin-2-ylpyridine-2-carboximidamide;2-(4-methylphenyl)naphthalene.
| Compound Name | N'-[amino-(6-pyridin-2-yl-2-pyridinyl)methyl]-6-pyridin-2-ylpyridine-2-carboximidamide;2-(4-methylphenyl)naphthalene |
|---|---|
| PubChem CID | 143633863 |
| Molecular Formula | C39H33N7 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | N'-[amino-(6-pyridin-2-yl-2-pyridinyl)methyl]-6-pyridin-2-ylpyridine-2-carboximidamide;2-(4-methylphenyl)naphthalene |
| SMILES | Cc1ccc(-c2ccc3ccccc3c2)cc1.N/C(=N\C(N)c1cccc(-c2ccccn2)n1)c1cccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C22H19N7.C17H14/c23-21(19-11-5-9-17(27-19)15-7-1-3-13-25-15)29-22(24)20-12-6-10-18(28-20)16-8-2-4-14-26-16;1-13-6-8-15(9-7-13)17-11-10-14-4-2-3-5-16(14)12-17/h1-14,21H,23H2,(H2,24,29);2-12H,1H3 |
| InChIKey | SUVZWUYBYYQOGI-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|