About 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene
1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene (PubChem CID 143637144) has the molecular formula C19H24F4
and a molecular weight of 328.39 g/mol. Its IUPAC name is 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene |
| PubChem CID | 143637144 |
| Molecular Formula | C19H24F4 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene |
| SMILES | CC.CCCc1cccc(F)c1F.CCc1ccc(F)cc1F |
| InChI | InChI=1S/C9H10F2.C8H8F2.C2H6/c1-2-4-7-5-3-6-8(10)9(7)11;1-2-6-3-4-7(9)5-8(6)10;1-2/h3,5-6H,2,4H2,1H3;3-5H,2H2,1H3;1-2H3 |
| InChIKey | KPAVVEJMRHCCJY-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene?
The IUPAC name of 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene (CID 143637144) is 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene.
What is the SMILES notation for 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene?
The canonical SMILES for 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene is CC.CCCc1cccc(F)c1F.CCc1ccc(F)cc1F.
What is the InChIKey of 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene?
The InChIKey is KPAVVEJMRHCCJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2.C8H8F2.C2H6/c1-2-4-7-5-3-6-8(10)9(7)11;1-2-6-3-4-7(9)5-8(6)10;1-2/h3,5-6H,2,4H2,1H3;3-5H,2H2,1H3;1-2H3.
What are the key properties of 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene?
1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene has a molecular weight of 328.39 g/mol, XLogP of 6.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-propylbenzene;ethane;1-ethyl-2,4-difluorobenzene is sourced from PubChem (CID 143637144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).