C17H35N3O6 — CID 143637317
2-(3-amino-2-oxopropoxy)-N-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 143637317) has the molecular formula C17H35N3O6 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-(3-amino-2-oxopropoxy)-N-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-(3-amino-2-oxopropoxy)-N-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 143637317 |
| Molecular Formula | C17H35N3O6 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2-(3-amino-2-oxopropoxy)-N-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CC(C)(C)NCCOCCOCCOCCNC(=O)COCC(=O)CN |
| InChI | InChI=1S/C17H35N3O6/c1-17(2,3)20-5-7-24-9-11-25-10-8-23-6-4-19-16(22)14-26-13-15(21)12-18/h20H,4-14,18H2,1-3H3,(H,19,22) |
| InChIKey | CFYDCKYTGDJEPO-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|