C12H19FO3 — CID 143638124
5-[(2E,4E)-4-fluorohepta-2,4,6-trien-2-yl]oxypentane-2,2-diol (PubChem CID 143638124) has the molecular formula C12H19FO3 and a molecular weight of 230.28 g/mol. Its IUPAC name is 5-[(2E,4E)-4-fluorohepta-2,4,6-trien-2-yl]oxypentane-2,2-diol.
| Compound Name | 5-[(2E,4E)-4-fluorohepta-2,4,6-trien-2-yl]oxypentane-2,2-diol |
|---|---|
| PubChem CID | 143638124 |
| Molecular Formula | C12H19FO3 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 5-[(2E,4E)-4-fluorohepta-2,4,6-trien-2-yl]oxypentane-2,2-diol |
| SMILES | C=C/C=C(F)\C=C(/C)OCCCC(C)(O)O |
| InChI | InChI=1S/C12H19FO3/c1-4-6-11(13)9-10(2)16-8-5-7-12(3,14)15/h4,6,9,14-15H,1,5,7-8H2,2-3H3/b10-9+,11-6+ |
| InChIKey | LCPUNZXFLJBLOA-HUJSXLBNSA-N |
| XLogP | 2.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|