C12H15BrFNO — CID 142802565
(2Z,4E)-5-(3-bromopropoxy)-3-fluoro-2-[(Z)-prop-1-enyl]hexa-2,4-dienenitrile (PubChem CID 142802565) has the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. Its IUPAC name is (2Z,4E)-5-(3-bromopropoxy)-3-fluoro-2-[(Z)-prop-1-enyl]hexa-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-(3-bromopropoxy)-3-fluoro-2-[(Z)-prop-1-enyl]hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 142802565 |
| Molecular Formula | C12H15BrFNO |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | (2Z,4E)-5-(3-bromopropoxy)-3-fluoro-2-[(Z)-prop-1-enyl]hexa-2,4-dienenitrile |
| SMILES | C/C=C\C(C#N)=C(F)/C=C(\C)OCCCBr |
| InChI | InChI=1S/C12H15BrFNO/c1-3-5-11(9-15)12(14)8-10(2)16-7-4-6-13/h3,5,8H,4,6-7H2,1-2H3/b5-3-,10-8+,12-11- |
| InChIKey | CPCGMVVXAMLHIY-BEMQCTHHSA-N |
| XLogP | 4.02 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|