C38H52O — CID 143642284
ethane;9-(4-methoxyphenyl)-2,7-bis(2-methylbutan-2-yl)-9-prop-1-en-2-ylfluorene;prop-1-ene (PubChem CID 143642284) has the molecular formula C38H52O and a molecular weight of 524.83 g/mol. Its IUPAC name is ethane;9-(4-methoxyphenyl)-2,7-bis(2-methylbutan-2-yl)-9-prop-1-en-2-ylfluorene;prop-1-ene.
| Compound Name | ethane;9-(4-methoxyphenyl)-2,7-bis(2-methylbutan-2-yl)-9-prop-1-en-2-ylfluorene;prop-1-ene |
|---|---|
| PubChem CID | 143642284 |
| Molecular Formula | C38H52O |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | ethane;9-(4-methoxyphenyl)-2,7-bis(2-methylbutan-2-yl)-9-prop-1-en-2-ylfluorene;prop-1-ene |
| SMILES | C=C(C)C1(c2ccc(OC)cc2)c2cc(C(C)(C)CC)ccc2-c2ccc(C(C)(C)CC)cc21.C=CC.CC |
| InChI | InChI=1S/C33H40O.C3H6.C2H6/c1-10-31(5,6)24-14-18-27-28-19-15-25(32(7,8)11-2)21-30(28)33(22(3)4,29(27)20-24)23-12-16-26(34-9)17-13-23;1-3-2;1-2/h12-21H,3,10-11H2,1-2,4-9H3;3H,1H2,2H3;1-2H3 |
| InChIKey | QLHHWYGLQUKVCB-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|