C22H34FN5O3 — CID 143642923
(4S)-12-[(dimethylamino)methyl]-22-fluoro-4-methyl-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-10,13-dione (PubChem CID 143642923) has the molecular formula C22H34FN5O3 and a molecular weight of 435.54 g/mol. Its IUPAC name is (4S)-12-[(dimethylamino)methyl]-22-fluoro-4-methyl-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-10,13-dione.
| Compound Name | (4S)-12-[(dimethylamino)methyl]-22-fluoro-4-methyl-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-10,13-dione |
|---|---|
| PubChem CID | 143642923 |
| Molecular Formula | C22H34FN5O3 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | (4S)-12-[(dimethylamino)methyl]-22-fluoro-4-methyl-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-10,13-dione |
| SMILES | C=C1CN[C@@H](C)COc2c(F)cccc2CCCNC(=O)C(CN(C)C)NC(=O)CN1 |
| InChI | InChI=1S/C22H34FN5O3/c1-15-11-25-16(2)14-31-21-17(7-5-9-18(21)23)8-6-10-24-22(30)19(13-28(3)4)27-20(29)12-26-15/h5,7,9,16,19,25-26H,1,6,8,10-14H2,2-4H3,(H,24,30)(H,27,29)/t16-,19?/m0/s1 |
| InChIKey | OVGFOHJSYJQEAT-UCFFOFKASA-N |
| XLogP | 0.39 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |