C20H31N7O4 — CID 143643059
2-[(4-methyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl)methyl]guanidine (PubChem CID 143643059) has the molecular formula C20H31N7O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[(4-methyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl)methyl]guanidine.
| Compound Name | 2-[(4-methyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl)methyl]guanidine |
|---|---|
| PubChem CID | 143643059 |
| Molecular Formula | C20H31N7O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[(4-methyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl)methyl]guanidine |
| SMILES | CC1COc2ccccc2CCCNC(=O)C(CN=C(N)N)NC(=O)CNC(=O)CN1 |
| InChI | InChI=1S/C20H31N7O4/c1-13-12-31-16-7-3-2-5-14(16)6-4-8-23-19(30)15(9-26-20(21)22)27-18(29)11-25-17(28)10-24-13/h2-3,5,7,13,15,24H,4,6,8-12H2,1H3,(H,23,30)(H,25,28)(H,27,29)(H4,21,22,26) |
| InChIKey | ALNJAHUOJYEVBC-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 172.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|