C22H34N4O3 — CID 143642866
(4S)-12-ethyl-4,16-dimethyl-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione (PubChem CID 143642866) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is (4S)-12-ethyl-4,16-dimethyl-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione.
| Compound Name | (4S)-12-ethyl-4,16-dimethyl-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione |
|---|---|
| PubChem CID | 143642866 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (4S)-12-ethyl-4,16-dimethyl-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione |
| SMILES | C=C1CN[C@@H](C)COc2ccccc2CC(C)CNC(=O)C(CC)NC(=O)CN1 |
| InChI | InChI=1S/C22H34N4O3/c1-5-19-22(28)25-11-15(2)10-18-8-6-7-9-20(18)29-14-17(4)23-12-16(3)24-13-21(27)26-19/h6-9,15,17,19,23-24H,3,5,10-14H2,1-2,4H3,(H,25,28)(H,26,27)/t15?,17-,19?/m0/s1 |
| InChIKey | NLVLAOOTHIAQJT-RMXPPQQLSA-N |
| XLogP | 1.35 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |