C32H43IN4O4 — CID 66596104
(6R,9R,12S)-12-(cyclopropylmethyl)-6-[(3-iodophenyl)methyl]-16-methyl-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 66596104) has the molecular formula C32H43IN4O4 and a molecular weight of 674.62 g/mol. Its IUPAC name is (6R,9R,12S)-12-(cyclopropylmethyl)-6-[(3-iodophenyl)methyl]-16-methyl-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6R,9R,12S)-12-(cyclopropylmethyl)-6-[(3-iodophenyl)methyl]-16-methyl-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 66596104 |
| Molecular Formula | C32H43IN4O4 |
| Molecular Weight | 674.62 g/mol |
| Exact Mass | 674.23 |
| IUPAC Name | (6R,9R,12S)-12-(cyclopropylmethyl)-6-[(3-iodophenyl)methyl]-16-methyl-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CC1CNC(=O)[C@H](CC2CC2)NC(=O)[C@@H](C(C)C)NC(=O)[C@@H](Cc2cccc(I)c2)NCCOc2ccccc2C1 |
| InChI | InChI=1S/C32H43IN4O4/c1-20(2)29-32(40)36-27(17-22-11-12-22)30(38)35-19-21(3)15-24-8-4-5-10-28(24)41-14-13-34-26(31(39)37-29)18-23-7-6-9-25(33)16-23/h4-10,16,20-22,26-27,29,34H,11-15,17-19H2,1-3H3,(H,35,38)(H,36,40)(H,37,39)/t21?,26-,27+,29-/m1/s1 |
| InChIKey | SSIYMKBGBCAGES-PSOJVBHWSA-N |
| XLogP | 3.61 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|