C32H43FN4O4 — CID 25119273
(6R,9R,12S)-12-(cyclopropylmethyl)-6-[(4-fluorophenyl)methyl]-17-methyl-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 25119273) has the molecular formula C32H43FN4O4 and a molecular weight of 566.72 g/mol. Its IUPAC name is (6R,9R,12S)-12-(cyclopropylmethyl)-6-[(4-fluorophenyl)methyl]-17-methyl-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6R,9R,12S)-12-(cyclopropylmethyl)-6-[(4-fluorophenyl)methyl]-17-methyl-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 25119273 |
| Molecular Formula | C32H43FN4O4 |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | (6R,9R,12S)-12-(cyclopropylmethyl)-6-[(4-fluorophenyl)methyl]-17-methyl-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CC1CCNC(=O)[C@H](CC2CC2)NC(=O)[C@@H](C(C)C)NC(=O)[C@@H](Cc2ccc(F)cc2)NCCOc2ccccc21 |
| InChI | InChI=1S/C32H43FN4O4/c1-20(2)29-32(40)36-27(19-22-8-9-22)30(38)35-15-14-21(3)25-6-4-5-7-28(25)41-17-16-34-26(31(39)37-29)18-23-10-12-24(33)13-11-23/h4-7,10-13,20-22,26-27,29,34H,8-9,14-19H2,1-3H3,(H,35,38)(H,36,40)(H,37,39)/t21?,26-,27+,29-/m1/s1 |
| InChIKey | HKYNJAQGPYFMBY-PSOJVBHWSA-N |
| XLogP | 3.45 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |