C30H51N5O2 — CID 143642880
(15S)-3,15-dimethyl-12-methylidene-7-[[pentyl(propyl)amino]methyl]-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-6,9-dione (PubChem CID 143642880) has the molecular formula C30H51N5O2 and a molecular weight of 513.77 g/mol. Its IUPAC name is (15S)-3,15-dimethyl-12-methylidene-7-[[pentyl(propyl)amino]methyl]-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-6,9-dione.
| Compound Name | (15S)-3,15-dimethyl-12-methylidene-7-[[pentyl(propyl)amino]methyl]-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-6,9-dione |
|---|---|
| PubChem CID | 143642880 |
| Molecular Formula | C30H51N5O2 |
| Molecular Weight | 513.77 g/mol |
| Exact Mass | 513.40 |
| IUPAC Name | (15S)-3,15-dimethyl-12-methylidene-7-[[pentyl(propyl)amino]methyl]-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-6,9-dione |
| SMILES | C=C1CN[C@@H](C)CCc2ccccc2CC(C)CNC(=O)C(CN(CCC)CCCCC)NC(=O)CN1 |
| InChI | InChI=1S/C30H51N5O2/c1-6-8-11-17-35(16-7-2)22-28-30(37)33-19-23(3)18-27-13-10-9-12-26(27)15-14-24(4)31-20-25(5)32-21-29(36)34-28/h9-10,12-13,23-24,28,31-32H,5-8,11,14-22H2,1-4H3,(H,33,37)(H,34,36)/t23?,24-,28?/m0/s1 |
| InChIKey | MAVHIKYYFOKFLU-MJMJPBAGSA-N |
| XLogP | 3.40 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|