C24H36N4O3 — CID 143643007
10-cyclobutylidene-12-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,13-dione (PubChem CID 143643007) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is 10-cyclobutylidene-12-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,13-dione.
| Compound Name | 10-cyclobutylidene-12-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,13-dione |
|---|---|
| PubChem CID | 143643007 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 10-cyclobutylidene-12-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,13-dione |
| SMILES | CCCC1NC(=C2CCC2)CNC(=O)CNCCOc2ccccc2CCCNC1=O |
| InChI | InChI=1S/C24H36N4O3/c1-2-7-20-24(30)26-13-6-11-19-8-3-4-12-22(19)31-15-14-25-17-23(29)27-16-21(28-20)18-9-5-10-18/h3-4,8,12,20,25,28H,2,5-7,9-11,13-17H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | OMYKTFVDLMZXHB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |