C29H42F3N5O4 — CID 143642952
12-(aminomethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione;1-methyl-3-(trifluoromethyl)benzene;propane (PubChem CID 143642952) has the molecular formula C29H42F3N5O4 and a molecular weight of 581.68 g/mol. Its IUPAC name is 12-(aminomethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione;1-methyl-3-(trifluoromethyl)benzene;propane.
| Compound Name | 12-(aminomethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione;1-methyl-3-(trifluoromethyl)benzene;propane |
|---|---|
| PubChem CID | 143642952 |
| Molecular Formula | C29H42F3N5O4 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 12-(aminomethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione;1-methyl-3-(trifluoromethyl)benzene;propane |
| SMILES | CCC.Cc1cccc(C(F)(F)F)c1.NCC1NC(=O)CNC(=O)CNCCOc2ccccc2CCCNC1=O |
| InChI | InChI=1S/C18H27N5O4.C8H7F3.C3H8/c19-10-14-18(26)21-7-3-5-13-4-1-2-6-15(13)27-9-8-20-11-16(24)22-12-17(25)23-14;1-6-3-2-4-7(5-6)8(9,10)11;1-3-2/h1-2,4,6,14,20H,3,5,7-12,19H2,(H,21,26)(H,22,24)(H,23,25);2-5H,1H3;3H2,1-2H3 |
| InChIKey | CJQLODUBTSTDSQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |