C23H33N5O4 — CID 143645719
5,6-dimethyl-1,3-benzodioxole;formamide;5-[2-methyl-4-(methylamino)imidazo[4,5-c]pyridin-1-yl]pentan-1-ol (PubChem CID 143645719) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 5,6-dimethyl-1,3-benzodioxole;formamide;5-[2-methyl-4-(methylamino)imidazo[4,5-c]pyridin-1-yl]pentan-1-ol.
| Compound Name | 5,6-dimethyl-1,3-benzodioxole;formamide;5-[2-methyl-4-(methylamino)imidazo[4,5-c]pyridin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 143645719 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 5,6-dimethyl-1,3-benzodioxole;formamide;5-[2-methyl-4-(methylamino)imidazo[4,5-c]pyridin-1-yl]pentan-1-ol |
| SMILES | CNc1nccc2c1nc(C)n2CCCCCO.Cc1cc2c(cc1C)OCO2.NC=O |
| InChI | InChI=1S/C13H20N4O.C9H10O2.CH3NO/c1-10-16-12-11(6-7-15-13(12)14-2)17(10)8-4-3-5-9-18;1-6-3-8-9(4-7(6)2)11-5-10-8;2-1-3/h6-7,18H,3-5,8-9H2,1-2H3,(H,14,15);3-4H,5H2,1-2H3;1H,(H2,2,3) |
| InChIKey | PXKATGSAZBQXFD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|