C24H34N6O4S — CID 145477719
ethane;N-hydroxy-5-[2-[4-(methylamino)-2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-1-yl]ethylamino]pentanamide (PubChem CID 145477719) has the molecular formula C24H34N6O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is ethane;N-hydroxy-5-[2-[4-(methylamino)-2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-1-yl]ethylamino]pentanamide.
| Compound Name | ethane;N-hydroxy-5-[2-[4-(methylamino)-2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-1-yl]ethylamino]pentanamide |
|---|---|
| PubChem CID | 145477719 |
| Molecular Formula | C24H34N6O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | ethane;N-hydroxy-5-[2-[4-(methylamino)-2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-1-yl]ethylamino]pentanamide |
| SMILES | CC.CNc1nccc2c1nc(Sc1cc3c(cc1C)OCO3)n2CCNCCCCC(=O)NO |
| InChI | InChI=1S/C22H28N6O4S.C2H6/c1-14-11-16-17(32-13-31-16)12-18(14)33-22-26-20-15(6-8-25-21(20)23-2)28(22)10-9-24-7-4-3-5-19(29)27-30;1-2/h6,8,11-12,24,30H,3-5,7,9-10,13H2,1-2H3,(H,23,25)(H,27,29);1-2H3 |
| InChIKey | WEUPDPPLOBUJMF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|