C21H24N4O2S — CID 145479860
ethane;2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine (PubChem CID 145479860) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is ethane;2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | ethane;2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 145479860 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | ethane;2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine |
| SMILES | C#CCCCn1c(Sc2cc3c(cc2C)OCO3)nc2c(N)nccc21.CC |
| InChI | InChI=1S/C19H18N4O2S.C2H6/c1-3-4-5-8-23-13-6-7-21-18(20)17(13)22-19(23)26-16-10-15-14(9-12(16)2)24-11-25-15;1-2/h1,6-7,9-10H,4-5,8,11H2,2H3,(H2,20,21);1-2H3 |
| InChIKey | JFQHLAGWQNRDRK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|