C21H25N5OS — CID 89243854
2-[2-(3-aminopropyl)-5-methoxyphenyl]sulfanyl-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine (PubChem CID 89243854) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[2-(3-aminopropyl)-5-methoxyphenyl]sulfanyl-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 2-[2-(3-aminopropyl)-5-methoxyphenyl]sulfanyl-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 89243854 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[2-(3-aminopropyl)-5-methoxyphenyl]sulfanyl-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine |
| SMILES | C#CCCCn1c(Sc2cc(OC)ccc2CCCN)nc2c(N)nccc21 |
| InChI | InChI=1S/C21H25N5OS/c1-3-4-5-13-26-17-10-12-24-20(23)19(17)25-21(26)28-18-14-16(27-2)9-8-15(18)7-6-11-22/h1,8-10,12,14H,4-7,11,13,22H2,2H3,(H2,23,24) |
| InChIKey | KEEUWJZCLRIGDQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|