C20H24ClN5OS — CID 143496328
2-chloro-8-(5-methoxy-2-methylphenyl)sulfanyl-9-pent-4-ynylpurin-6-amine;ethane (PubChem CID 143496328) has the molecular formula C20H24ClN5OS and a molecular weight of 417.97 g/mol. Its IUPAC name is 2-chloro-8-(5-methoxy-2-methylphenyl)sulfanyl-9-pent-4-ynylpurin-6-amine;ethane.
| Compound Name | 2-chloro-8-(5-methoxy-2-methylphenyl)sulfanyl-9-pent-4-ynylpurin-6-amine;ethane |
|---|---|
| PubChem CID | 143496328 |
| Molecular Formula | C20H24ClN5OS |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-chloro-8-(5-methoxy-2-methylphenyl)sulfanyl-9-pent-4-ynylpurin-6-amine;ethane |
| SMILES | C#CCCCn1c(Sc2cc(OC)ccc2C)nc2c(N)nc(Cl)nc21.CC |
| InChI | InChI=1S/C18H18ClN5OS.C2H6/c1-4-5-6-9-24-16-14(15(20)22-17(19)23-16)21-18(24)26-13-10-12(25-3)8-7-11(13)2;1-2/h1,7-8,10H,5-6,9H2,2-3H3,(H2,20,22,23);1-2H3 |
| InChIKey | HFAXYRYGMXOHED-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|