C20H27NO5 — CID 143648619
6-ethoxy-6-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-1,3,4,5,7,8-hexahydroisoquinoline-2-carbaldehyde (PubChem CID 143648619) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 6-ethoxy-6-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-1,3,4,5,7,8-hexahydroisoquinoline-2-carbaldehyde.
| Compound Name | 6-ethoxy-6-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-1,3,4,5,7,8-hexahydroisoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 143648619 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 6-ethoxy-6-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-1,3,4,5,7,8-hexahydroisoquinoline-2-carbaldehyde |
| SMILES | CCOC1(O)CCC2=C(CCN(C=O)C2Cc2ccc(OC)c(O)c2)C1 |
| InChI | InChI=1S/C20H27NO5/c1-3-26-20(24)8-6-16-15(12-20)7-9-21(13-22)17(16)10-14-4-5-19(25-2)18(23)11-14/h4-5,11,13,17,23-24H,3,6-10,12H2,1-2H3 |
| InChIKey | IRZKPVYFGFPOQS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|