C18H21NO4 — CID 606089
1-[(2,4-dihydroxyphenyl)methyl]-6-methoxy-3,4,5,8-tetrahydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 606089) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-[(2,4-dihydroxyphenyl)methyl]-6-methoxy-3,4,5,8-tetrahydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 1-[(2,4-dihydroxyphenyl)methyl]-6-methoxy-3,4,5,8-tetrahydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 606089 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[(2,4-dihydroxyphenyl)methyl]-6-methoxy-3,4,5,8-tetrahydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | COC1=CCC2=C(CCN(C=O)C2Cc2ccc(O)cc2O)C1 |
| InChI | InChI=1S/C18H21NO4/c1-23-15-4-5-16-12(8-15)6-7-19(11-20)17(16)9-13-2-3-14(21)10-18(13)22/h2-4,10-11,17,21-22H,5-9H2,1H3 |
| InChIKey | UENLJQSDVNDMGB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|