C19H22N2O4 — CID 143648621
6-methoxy-1-[(4-methoxy-3-nitrosophenyl)methyl]-3,4,5,8-tetrahydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 143648621) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 6-methoxy-1-[(4-methoxy-3-nitrosophenyl)methyl]-3,4,5,8-tetrahydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 6-methoxy-1-[(4-methoxy-3-nitrosophenyl)methyl]-3,4,5,8-tetrahydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 143648621 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 6-methoxy-1-[(4-methoxy-3-nitrosophenyl)methyl]-3,4,5,8-tetrahydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | COC1=CCC2=C(CCN(C=O)C2Cc2ccc(OC)c(N=O)c2)C1 |
| InChI | InChI=1S/C19H22N2O4/c1-24-15-4-5-16-14(11-15)7-8-21(12-22)18(16)10-13-3-6-19(25-2)17(9-13)20-23/h3-4,6,9,12,18H,5,7-8,10-11H2,1-2H3 |
| InChIKey | ITXXUFZPHRALKP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|