C6H8N2O2S — CID 143650138
propyl 1,3,4-thiadiazole-2-carboxylate (PubChem CID 143650138) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is propyl 1,3,4-thiadiazole-2-carboxylate.
| Compound Name | propyl 1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 143650138 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | propyl 1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCOC(=O)c1nncs1 |
| InChI | InChI=1S/C6H8N2O2S/c1-2-3-10-6(9)5-8-7-4-11-5/h4H,2-3H2,1H3 |
| InChIKey | HRXYFOYKTAVUST-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |