C13H25NS — CID 143657128
ethane;(5Z)-2-ethenylsulfanyl-5-methylocta-1,5-dien-3-amine (PubChem CID 143657128) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is ethane;(5Z)-2-ethenylsulfanyl-5-methylocta-1,5-dien-3-amine.
| Compound Name | ethane;(5Z)-2-ethenylsulfanyl-5-methylocta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 143657128 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | ethane;(5Z)-2-ethenylsulfanyl-5-methylocta-1,5-dien-3-amine |
| SMILES | C=CSC(=C)C(N)C/C(C)=C\CC.CC |
| InChI | InChI=1S/C11H19NS.C2H6/c1-5-7-9(3)8-11(12)10(4)13-6-2;1-2/h6-7,11H,2,4-5,8,12H2,1,3H3;1-2H3/b9-7-; |
| InChIKey | DVZGTGUQMQAJQV-VILQZVERSA-N |
| XLogP | 4.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|