C12H17NS — CID 143660704
(1E,3Z)-2-ethenyl-3-(2-methylidenebutylideneamino)penta-1,3-diene-1-thiol (PubChem CID 143660704) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is (1E,3Z)-2-ethenyl-3-(2-methylidenebutylideneamino)penta-1,3-diene-1-thiol.
| Compound Name | (1E,3Z)-2-ethenyl-3-(2-methylidenebutylideneamino)penta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 143660704 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (1E,3Z)-2-ethenyl-3-(2-methylidenebutylideneamino)penta-1,3-diene-1-thiol |
| SMILES | C=C/C(=C\S)C(=CC)/N=C/C(=C)CC |
| InChI | InChI=1S/C12H17NS/c1-5-10(4)8-13-12(7-3)11(6-2)9-14/h6-9,14H,2,4-5H2,1,3H3/b11-9+,12-7-,13-8+ |
| InChIKey | TWIAKDDQIHCWRX-LESCMQHFSA-N |
| XLogP | 3.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|