C18H18BrNO2S — CID 143663174
ethyl 8-bromo-2-phenylsulfanyl-3,4-dihydro-1H-isoquinoline-1-carboxylate (PubChem CID 143663174) has the molecular formula C18H18BrNO2S and a molecular weight of 392.32 g/mol. Its IUPAC name is ethyl 8-bromo-2-phenylsulfanyl-3,4-dihydro-1H-isoquinoline-1-carboxylate.
| Compound Name | ethyl 8-bromo-2-phenylsulfanyl-3,4-dihydro-1H-isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 143663174 |
| Molecular Formula | C18H18BrNO2S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | ethyl 8-bromo-2-phenylsulfanyl-3,4-dihydro-1H-isoquinoline-1-carboxylate |
| SMILES | CCOC(=O)C1c2c(Br)cccc2CCN1Sc1ccccc1 |
| InChI | InChI=1S/C18H18BrNO2S/c1-2-22-18(21)17-16-13(7-6-10-15(16)19)11-12-20(17)23-14-8-4-3-5-9-14/h3-10,17H,2,11-12H2,1H3 |
| InChIKey | BPWPNIQMHVLFBD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|