C35H36F3N7O3 — CID 143663371
1-(2-amino-2-oxoethyl)-2-(3-phenylmethoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide;2-propylguanidine (PubChem CID 143663371) has the molecular formula C35H36F3N7O3 and a molecular weight of 659.71 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-2-(3-phenylmethoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide;2-propylguanidine.
| Compound Name | 1-(2-amino-2-oxoethyl)-2-(3-phenylmethoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide;2-propylguanidine |
|---|---|
| PubChem CID | 143663371 |
| Molecular Formula | C35H36F3N7O3 |
| Molecular Weight | 659.71 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-2-(3-phenylmethoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide;2-propylguanidine |
| SMILES | CCCN=C(N)N.NC(=O)Cn1c(-c2cccc(OCc3ccccc3)c2)nc2cc(C(=O)NCc3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C31H25F3N4O3.C4H11N3/c32-31(33,34)24-10-4-8-21(14-24)17-36-30(40)23-12-13-27-26(16-23)37-29(38(27)18-28(35)39)22-9-5-11-25(15-22)41-19-20-6-2-1-3-7-20;1-2-3-7-4(5)6/h1-16H,17-19H2,(H2,35,39)(H,36,40);2-3H2,1H3,(H4,5,6,7) |
| InChIKey | FMQFYEOUIXVSPR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 163.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|