C15H25FN2O2 — CID 143666986
ethane;N'-(2-fluoro-4-methylphenyl)-3-oxopropanimidamide;methoxyethane (PubChem CID 143666986) has the molecular formula C15H25FN2O2 and a molecular weight of 284.38 g/mol. Its IUPAC name is ethane;N'-(2-fluoro-4-methylphenyl)-3-oxopropanimidamide;methoxyethane.
| Compound Name | ethane;N'-(2-fluoro-4-methylphenyl)-3-oxopropanimidamide;methoxyethane |
|---|---|
| PubChem CID | 143666986 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | ethane;N'-(2-fluoro-4-methylphenyl)-3-oxopropanimidamide;methoxyethane |
| SMILES | CC.CCOC.Cc1ccc(/N=C(/N)CC=O)c(F)c1 |
| InChI | InChI=1S/C10H11FN2O.C3H8O.C2H6/c1-7-2-3-9(8(11)6-7)13-10(12)4-5-14;1-3-4-2;1-2/h2-3,5-6H,4H2,1H3,(H2,12,13);3H2,1-2H3;1-2H3 |
| InChIKey | KDSIDUUKCKTTDN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|