C13H12O2 — CID 143668942
1-hydroxy-1,2,9,9a-tetrahydrofluoren-3-one (PubChem CID 143668942) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-hydroxy-1,2,9,9a-tetrahydrofluoren-3-one.
| Compound Name | 1-hydroxy-1,2,9,9a-tetrahydrofluoren-3-one |
|---|---|
| PubChem CID | 143668942 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-hydroxy-1,2,9,9a-tetrahydrofluoren-3-one |
| SMILES | O=C1C=C2c3ccccc3CC2C(O)C1 |
| InChI | InChI=1S/C13H12O2/c14-9-6-11-10-4-2-1-3-8(10)5-12(11)13(15)7-9/h1-4,6,12-13,15H,5,7H2 |
| InChIKey | NLPNWSBCBLNRKI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |