C8H13FN2 — CID 143671711
N'-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]methanediamine (PubChem CID 143671711) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is N'-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]methanediamine.
| Compound Name | N'-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]methanediamine |
|---|---|
| PubChem CID | 143671711 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | N'-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]methanediamine |
| SMILES | C=C(F)/C=C\C(=C)CNCN |
| InChI | InChI=1S/C8H13FN2/c1-7(5-11-6-10)3-4-8(2)9/h3-4,11H,1-2,5-6,10H2/b4-3- |
| InChIKey | UTRHSPQUEKVKHR-ARJAWSKDSA-N |
| XLogP | 1.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|