C31H39ClN2O — CID 143672698
acetaldehyde;5-[5-[1-(4-benzylpiperidin-1-yl)ethenyl]-2-ethylphenyl]-2-chloropyridine;ethane (PubChem CID 143672698) has the molecular formula C31H39ClN2O and a molecular weight of 491.12 g/mol. Its IUPAC name is acetaldehyde;5-[5-[1-(4-benzylpiperidin-1-yl)ethenyl]-2-ethylphenyl]-2-chloropyridine;ethane.
| Compound Name | acetaldehyde;5-[5-[1-(4-benzylpiperidin-1-yl)ethenyl]-2-ethylphenyl]-2-chloropyridine;ethane |
|---|---|
| PubChem CID | 143672698 |
| Molecular Formula | C31H39ClN2O |
| Molecular Weight | 491.12 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | acetaldehyde;5-[5-[1-(4-benzylpiperidin-1-yl)ethenyl]-2-ethylphenyl]-2-chloropyridine;ethane |
| SMILES | C=C(c1ccc(CC)c(-c2ccc(Cl)nc2)c1)N1CCC(Cc2ccccc2)CC1.CC.CC=O |
| InChI | InChI=1S/C27H29ClN2.C2H4O.C2H6/c1-3-23-9-10-24(18-26(23)25-11-12-27(28)29-19-25)20(2)30-15-13-22(14-16-30)17-21-7-5-4-6-8-21;1-2-3;1-2/h4-12,18-19,22H,2-3,13-17H2,1H3;2H,1H3;1-2H3 |
| InChIKey | OKIJKDDKTGQJFQ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.12 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|