C18H26 — CID 143674823
ethane;3'-ethylidenespiro[1,2-dihydroindene-3,1'-cyclohexane] (PubChem CID 143674823) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is ethane;3'-ethylidenespiro[1,2-dihydroindene-3,1'-cyclohexane].
| Compound Name | ethane;3'-ethylidenespiro[1,2-dihydroindene-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 143674823 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethane;3'-ethylidenespiro[1,2-dihydroindene-3,1'-cyclohexane] |
| SMILES | CC.CC=C1CCCC2(CCc3ccccc32)C1 |
| InChI | InChI=1S/C16H20.C2H6/c1-2-13-6-5-10-16(12-13)11-9-14-7-3-4-8-15(14)16;1-2/h2-4,7-8H,5-6,9-12H2,1H3;1-2H3 |
| InChIKey | VVYJYIKVTMYWDT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|