C29H32FN5O2 — CID 143677339
5-[4-[amino(methylamino)methoxy]-3-fluorophenyl]-3-[[4-(2-aminophenyl)phenyl]methyl]-6-methyl-2-propylpyrimidin-4-one (PubChem CID 143677339) has the molecular formula C29H32FN5O2 and a molecular weight of 501.61 g/mol. Its IUPAC name is 5-[4-[amino(methylamino)methoxy]-3-fluorophenyl]-3-[[4-(2-aminophenyl)phenyl]methyl]-6-methyl-2-propylpyrimidin-4-one.
| Compound Name | 5-[4-[amino(methylamino)methoxy]-3-fluorophenyl]-3-[[4-(2-aminophenyl)phenyl]methyl]-6-methyl-2-propylpyrimidin-4-one |
|---|---|
| PubChem CID | 143677339 |
| Molecular Formula | C29H32FN5O2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 5-[4-[amino(methylamino)methoxy]-3-fluorophenyl]-3-[[4-(2-aminophenyl)phenyl]methyl]-6-methyl-2-propylpyrimidin-4-one |
| SMILES | CCCc1nc(C)c(-c2ccc(OC(N)NC)c(F)c2)c(=O)n1Cc1ccc(-c2ccccc2N)cc1 |
| InChI | InChI=1S/C29H32FN5O2/c1-4-7-26-34-18(2)27(21-14-15-25(23(30)16-21)37-29(32)33-3)28(36)35(26)17-19-10-12-20(13-11-19)22-8-5-6-9-24(22)31/h5-6,8-16,29,33H,4,7,17,31-32H2,1-3H3 |
| InChIKey | OUQUTVXOFZFTER-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|