C51H46N6O3 — CID 67801314
[3-[[4-methyl-6-oxo-2-propyl-1-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-5-yl]methyl]phenyl]methyl acetate (PubChem CID 67801314) has the molecular formula C51H46N6O3 and a molecular weight of 790.97 g/mol. Its IUPAC name is [3-[[4-methyl-6-oxo-2-propyl-1-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-5-yl]methyl]phenyl]methyl acetate.
| Compound Name | [3-[[4-methyl-6-oxo-2-propyl-1-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-5-yl]methyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 67801314 |
| Molecular Formula | C51H46N6O3 |
| Molecular Weight | 790.97 g/mol |
| Exact Mass | 790.36 |
| IUPAC Name | [3-[[4-methyl-6-oxo-2-propyl-1-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-5-yl]methyl]phenyl]methyl acetate |
| SMILES | CCCc1nc(C)c(Cc2cccc(COC(C)=O)c2)c(=O)n1Cc1ccc(-c2ccccc2C2(C(c3ccccc3)(c3ccccc3)c3ccccc3)N=NN=N2)cc1 |
| InChI | InChI=1S/C51H46N6O3/c1-4-17-48-52-36(2)46(33-39-18-16-19-40(32-39)35-60-37(3)58)49(59)57(48)34-38-28-30-41(31-29-38)45-26-14-15-27-47(45)51(53-55-56-54-51)50(42-20-8-5-9-21-42,43-22-10-6-11-23-43)44-24-12-7-13-25-44/h5-16,18-32H,4,17,33-35H2,1-3H3 |
| InChIKey | RHAZLVJKTIJSDO-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 110.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.97 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|