C42H37F3N6O — CID 57090795
[2-butyl-5-(trifluoromethyl)-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol (PubChem CID 57090795) has the molecular formula C42H37F3N6O and a molecular weight of 698.79 g/mol. Its IUPAC name is [2-butyl-5-(trifluoromethyl)-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol.
| Compound Name | [2-butyl-5-(trifluoromethyl)-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 57090795 |
| Molecular Formula | C42H37F3N6O |
| Molecular Weight | 698.79 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | [2-butyl-5-(trifluoromethyl)-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol |
| SMILES | CCCCc1nc(C(F)(F)F)c(CO)n1Cc1ccc(-c2ccccc2C2(C(c3ccccc3)(c3ccccc3)c3ccccc3)N=NN=N2)cc1 |
| InChI | InChI=1S/C42H37F3N6O/c1-2-3-23-38-46-39(42(43,44)45)37(29-52)51(38)28-30-24-26-31(27-25-30)35-21-13-14-22-36(35)41(47-49-50-48-41)40(32-15-7-4-8-16-32,33-17-9-5-10-18-33)34-19-11-6-12-20-34/h4-22,24-27,52H,2-3,23,28-29H2,1H3 |
| InChIKey | GCQUHVZUZDRNGK-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.79 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|