C47H48N6O — CID 57256597
2-butyl-5-cyclohexyl-5-methyl-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-one (PubChem CID 57256597) has the molecular formula C47H48N6O and a molecular weight of 712.94 g/mol. Its IUPAC name is 2-butyl-5-cyclohexyl-5-methyl-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-one.
| Compound Name | 2-butyl-5-cyclohexyl-5-methyl-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-one |
|---|---|
| PubChem CID | 57256597 |
| Molecular Formula | C47H48N6O |
| Molecular Weight | 712.94 g/mol |
| Exact Mass | 712.39 |
| IUPAC Name | 2-butyl-5-cyclohexyl-5-methyl-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-one |
| SMILES | CCCCC1=NC(C)(C2CCCCC2)C(=O)N1Cc1ccc(-c2ccccc2C2(C(c3ccccc3)(c3ccccc3)c3ccccc3)N=NN=N2)cc1 |
| InChI | InChI=1S/C47H48N6O/c1-3-4-29-43-48-45(2,37-19-9-5-10-20-37)44(54)53(43)34-35-30-32-36(33-31-35)41-27-17-18-28-42(41)47(49-51-52-50-47)46(38-21-11-6-12-22-38,39-23-13-7-14-24-39)40-25-15-8-16-26-40/h6-8,11-18,21-28,30-33,37H,3-5,9-10,19-20,29,34H2,1-2H3 |
| InChIKey | CNHIFMFDFSMRCB-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 82.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.94 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|