C45H44N6O3 — CID 57015545
ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 57015545) has the molecular formula C45H44N6O3 and a molecular weight of 716.89 g/mol. Its IUPAC name is ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 57015545 |
| Molecular Formula | C45H44N6O3 |
| Molecular Weight | 716.89 g/mol |
| Exact Mass | 716.35 |
| IUPAC Name | ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)OCC)n1Cc1ccc(-c2ccccc2C2(C(c3ccccc3)(c3ccccc3)c3ccccc3)N=NN=N2)cc1 |
| InChI | InChI=1S/C45H44N6O3/c1-5-18-39-46-41(43(3,4)53)40(42(52)54-6-2)51(39)31-32-27-29-33(30-28-32)37-25-16-17-26-38(37)45(47-49-50-48-45)44(34-19-10-7-11-20-34,35-21-12-8-13-22-35)36-23-14-9-15-24-36/h7-17,19-30,53H,5-6,18,31H2,1-4H3 |
| InChIKey | JWBNZTKDKYLAMP-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.89 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|