C44H42N6O3S — CID 57040928
ethyl 2-ethylsulfanyl-5-(2-hydroxypropan-2-yl)-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 57040928) has the molecular formula C44H42N6O3S and a molecular weight of 734.93 g/mol. Its IUPAC name is ethyl 2-ethylsulfanyl-5-(2-hydroxypropan-2-yl)-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | ethyl 2-ethylsulfanyl-5-(2-hydroxypropan-2-yl)-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 57040928 |
| Molecular Formula | C44H42N6O3S |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.30 |
| IUPAC Name | ethyl 2-ethylsulfanyl-5-(2-hydroxypropan-2-yl)-3-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)(C)O)nc(SCC)n1Cc1ccc(-c2ccccc2C2(C(c3ccccc3)(c3ccccc3)c3ccccc3)N=NN=N2)cc1 |
| InChI | InChI=1S/C44H42N6O3S/c1-5-53-40(51)38-39(42(3,4)52)45-41(54-6-2)50(38)30-31-26-28-32(29-27-31)36-24-16-17-25-37(36)44(46-48-49-47-44)43(33-18-10-7-11-19-33,34-20-12-8-13-21-34)35-22-14-9-15-23-35/h7-29,52H,5-6,30H2,1-4H3 |
| InChIKey | ZAXQBJQMKZIWAL-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|