C22H34O3 — CID 143680979
1-[(4'aS,11'R)-7',7',11'-trimethylspiro[1,3-dioxolane-2,8'-2,3,4,5,6,6a,9,10,11,11a-decahydrocyclohepta[a]naphthalene]-4'a-yl]ethanone (PubChem CID 143680979) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 1-[(4'aS,11'R)-7',7',11'-trimethylspiro[1,3-dioxolane-2,8'-2,3,4,5,6,6a,9,10,11,11a-decahydrocyclohepta[a]naphthalene]-4'a-yl]ethanone.
| Compound Name | 1-[(4'aS,11'R)-7',7',11'-trimethylspiro[1,3-dioxolane-2,8'-2,3,4,5,6,6a,9,10,11,11a-decahydrocyclohepta[a]naphthalene]-4'a-yl]ethanone |
|---|---|
| PubChem CID | 143680979 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 1-[(4'aS,11'R)-7',7',11'-trimethylspiro[1,3-dioxolane-2,8'-2,3,4,5,6,6a,9,10,11,11a-decahydrocyclohepta[a]naphthalene]-4'a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCCC=C1C1C(CC2)C(C)(C)C2(CC[C@H]1C)OCCO2 |
| InChI | InChI=1S/C22H34O3/c1-15-8-12-22(24-13-14-25-22)20(3,4)17-9-11-21(16(2)23)10-6-5-7-18(21)19(15)17/h7,15,17,19H,5-6,8-14H2,1-4H3/t15-,17?,19?,21-/m1/s1 |
| InChIKey | RBYHDHSRNBQQAI-VBUZLMFOSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|