C17H26O3 — CID 127054619
(1R,4aS,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5,5,8a-trimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one (PubChem CID 127054619) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (1R,4aS,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5,5,8a-trimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (1R,4aS,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5,5,8a-trimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 127054619 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (1R,4aS,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5,5,8a-trimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one |
| SMILES | CC1(C)C=CC[C@]2(C)[C@@H](CC3OCCO3)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C17H26O3/c1-16(2)7-4-8-17(3)12(11-15-19-9-10-20-15)13(18)5-6-14(16)17/h4,7,12,14-15H,5-6,8-11H2,1-3H3/t12-,14-,17+/m0/s1 |
| InChIKey | ASUINOWCLUFUJX-RVSPLBMKSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|