About 1-ethyl-2-propylcyclopropane;1-methoxypropane
1-ethyl-2-propylcyclopropane;1-methoxypropane (PubChem CID 143686065) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is 1-ethyl-2-propylcyclopropane;1-methoxypropane.
Molecular Properties
| Compound Name | 1-ethyl-2-propylcyclopropane;1-methoxypropane |
| PubChem CID | 143686065 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 1-ethyl-2-propylcyclopropane;1-methoxypropane |
| SMILES | CCCC1CC1CC.CCCOC |
| InChI | InChI=1S/C8H16.C4H10O/c1-3-5-8-6-7(8)4-2;1-3-4-5-2/h7-8H,3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | ZYPGRUJRJBVSHB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-2-propylcyclopropane;1-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-propylcyclopropane;1-methoxypropane?
The IUPAC name of 1-ethyl-2-propylcyclopropane;1-methoxypropane (CID 143686065) is 1-ethyl-2-propylcyclopropane;1-methoxypropane.
What is the SMILES notation for 1-ethyl-2-propylcyclopropane;1-methoxypropane?
The canonical SMILES for 1-ethyl-2-propylcyclopropane;1-methoxypropane is CCCC1CC1CC.CCCOC.
What is the InChIKey of 1-ethyl-2-propylcyclopropane;1-methoxypropane?
The InChIKey is ZYPGRUJRJBVSHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.C4H10O/c1-3-5-8-6-7(8)4-2;1-3-4-5-2/h7-8H,3-6H2,1-2H3;3-4H2,1-2H3.
What are the key properties of 1-ethyl-2-propylcyclopropane;1-methoxypropane?
1-ethyl-2-propylcyclopropane;1-methoxypropane has a molecular weight of 186.34 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-propylcyclopropane;1-methoxypropane is sourced from PubChem (CID 143686065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).