About 3-methylheptane;oxirane
3-methylheptane;oxirane (PubChem CID 87730052) has the molecular formula C10H22O
and a molecular weight of 158.28 g/mol. Its IUPAC name is 3-methylheptane;oxirane.
Molecular Properties
| Compound Name | 3-methylheptane;oxirane |
| PubChem CID | 87730052 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 3-methylheptane;oxirane |
| SMILES | C1CO1.CCCCC(C)CC |
| InChI | InChI=1S/C8H18.C2H4O/c1-4-6-7-8(3)5-2;1-2-3-1/h8H,4-7H2,1-3H3;1-2H2 |
| InChIKey | USWWGSIZKPJCIJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methylheptane;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptane;oxirane?
The IUPAC name of 3-methylheptane;oxirane (CID 87730052) is 3-methylheptane;oxirane.
What is the SMILES notation for 3-methylheptane;oxirane?
The canonical SMILES for 3-methylheptane;oxirane is C1CO1.CCCCC(C)CC.
What is the InChIKey of 3-methylheptane;oxirane?
The InChIKey is USWWGSIZKPJCIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C2H4O/c1-4-6-7-8(3)5-2;1-2-3-1/h8H,4-7H2,1-3H3;1-2H2.
What are the key properties of 3-methylheptane;oxirane?
3-methylheptane;oxirane has a molecular weight of 158.28 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptane;oxirane is sourced from PubChem (CID 87730052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).