C24H30 — CID 143687855
9-(2,2,5,5-tetramethylhexan-3-yl)anthracene (PubChem CID 143687855) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is 9-(2,2,5,5-tetramethylhexan-3-yl)anthracene.
| Compound Name | 9-(2,2,5,5-tetramethylhexan-3-yl)anthracene |
|---|---|
| PubChem CID | 143687855 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 9-(2,2,5,5-tetramethylhexan-3-yl)anthracene |
| SMILES | CC(C)(C)CC(c1c2ccccc2cc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C24H30/c1-23(2,3)16-21(24(4,5)6)22-19-13-9-7-11-17(19)15-18-12-8-10-14-20(18)22/h7-15,21H,16H2,1-6H3 |
| InChIKey | ZGSSQOAEBJAAIH-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|