About 4-(benzenesulfinyl)phenol;2-methylpropane;propane
4-(benzenesulfinyl)phenol;2-methylpropane;propane (PubChem CID 143694404) has the molecular formula C19H28O2S
and a molecular weight of 320.50 g/mol. Its IUPAC name is 4-(benzenesulfinyl)phenol;2-methylpropane;propane.
Molecular Properties
| Compound Name | 4-(benzenesulfinyl)phenol;2-methylpropane;propane |
| PubChem CID | 143694404 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 4-(benzenesulfinyl)phenol;2-methylpropane;propane |
| SMILES | CC(C)C.CCC.O=S(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H10O2S.C4H10.C3H8/c13-10-6-8-12(9-7-10)15(14)11-4-2-1-3-5-11;1-4(2)3;1-3-2/h1-9,13H;4H,1-3H3;3H2,1-2H3 |
| InChIKey | ZHUAZYZUAPIHNT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(benzenesulfinyl)phenol;2-methylpropane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfinyl)phenol;2-methylpropane;propane?
The IUPAC name of 4-(benzenesulfinyl)phenol;2-methylpropane;propane (CID 143694404) is 4-(benzenesulfinyl)phenol;2-methylpropane;propane.
What is the SMILES notation for 4-(benzenesulfinyl)phenol;2-methylpropane;propane?
The canonical SMILES for 4-(benzenesulfinyl)phenol;2-methylpropane;propane is CC(C)C.CCC.O=S(c1ccccc1)c1ccc(O)cc1.
What is the InChIKey of 4-(benzenesulfinyl)phenol;2-methylpropane;propane?
The InChIKey is ZHUAZYZUAPIHNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S.C4H10.C3H8/c13-10-6-8-12(9-7-10)15(14)11-4-2-1-3-5-11;1-4(2)3;1-3-2/h1-9,13H;4H,1-3H3;3H2,1-2H3.
What are the key properties of 4-(benzenesulfinyl)phenol;2-methylpropane;propane?
4-(benzenesulfinyl)phenol;2-methylpropane;propane has a molecular weight of 320.50 g/mol, XLogP of 5.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfinyl)phenol;2-methylpropane;propane is sourced from PubChem (CID 143694404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).