C23H30ClNO2 — CID 143697469
[4-chloro-3-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]-[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]methanone (PubChem CID 143697469) has the molecular formula C23H30ClNO2 and a molecular weight of 387.95 g/mol. Its IUPAC name is [4-chloro-3-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]-[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]methanone.
| Compound Name | [4-chloro-3-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]-[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 143697469 |
| Molecular Formula | C23H30ClNO2 |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | [4-chloro-3-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]-[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]methanone |
| SMILES | C=C/C=C(\C=C)Oc1cc(C(=O)C2(CCC(C)(C)C)CCNC2)ccc1Cl |
| InChI | InChI=1S/C23H30ClNO2/c1-6-8-18(7-2)27-20-15-17(9-10-19(20)24)21(26)23(13-14-25-16-23)12-11-22(3,4)5/h6-10,15,25H,1-2,11-14,16H2,3-5H3/b18-8+ |
| InChIKey | PSRKXIZZQXTJAF-QGMBQPNBSA-N |
| XLogP | 5.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|