C26H32FIN2O3S — CID 143698147
[(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-4-(iodomethyl)piperidin-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate (PubChem CID 143698147) has the molecular formula C26H32FIN2O3S and a molecular weight of 598.52 g/mol. Its IUPAC name is [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-4-(iodomethyl)piperidin-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate.
| Compound Name | [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-4-(iodomethyl)piperidin-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 143698147 |
| Molecular Formula | C26H32FIN2O3S |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-4-(iodomethyl)piperidin-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate |
| SMILES | CC(C(=O)O[C@H]1CN(CC(=O)c2cccc(F)c2)CCC1CI)(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C26H32FIN2O3S/c1-26(24-9-6-14-34-24,30-11-3-2-4-12-30)25(32)33-23-18-29(13-10-20(23)16-28)17-22(31)19-7-5-8-21(27)15-19/h5-9,14-15,20,23H,2-4,10-13,16-18H2,1H3/t20?,23-,26?/m0/s1 |
| InChIKey | CIMWHGBKWOKUTF-BAOIDCNMSA-N |
| XLogP | 5.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|