C17H22O3 — CID 143707574
10-methyl-10-prop-2-enoyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid (PubChem CID 143707574) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 10-methyl-10-prop-2-enoyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid.
| Compound Name | 10-methyl-10-prop-2-enoyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid |
|---|---|
| PubChem CID | 143707574 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 10-methyl-10-prop-2-enoyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid |
| SMILES | C=CC(=O)C1(C)CC2CC1C1C3CC(CC3C(=O)O)C21 |
| InChI | InChI=1S/C17H22O3/c1-3-13(18)17(2)7-9-6-12(17)15-10-4-8(14(9)15)5-11(10)16(19)20/h3,8-12,14-15H,1,4-7H2,2H3,(H,19,20) |
| InChIKey | ANDSGDCVSFUOHD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|