C19H23FN2O2 — CID 143709169
fluoro 7-tert-butyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate (PubChem CID 143709169) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is fluoro 7-tert-butyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate.
| Compound Name | fluoro 7-tert-butyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 143709169 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | fluoro 7-tert-butyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate |
| SMILES | C=CCc1c(C(=O)OF)[nH]c2cc3c(nc12)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C19H23FN2O2/c1-5-6-13-16-15(22-17(13)18(23)24-20)10-11-9-12(19(2,3)4)7-8-14(11)21-16/h5,10,12,22H,1,6-9H2,2-4H3 |
| InChIKey | GSKKBTWOXXTOEN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|