C13H22N2 — CID 143710802
(3E,5Z)-N,2,3,6-tetramethyl-1-methyliminoocta-3,5,7-trien-2-amine (PubChem CID 143710802) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (3E,5Z)-N,2,3,6-tetramethyl-1-methyliminoocta-3,5,7-trien-2-amine.
| Compound Name | (3E,5Z)-N,2,3,6-tetramethyl-1-methyliminoocta-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 143710802 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (3E,5Z)-N,2,3,6-tetramethyl-1-methyliminoocta-3,5,7-trien-2-amine |
| SMILES | C=C/C(C)=C\C=C(/C)C(C)(/C=N/C)NC |
| InChI | InChI=1S/C13H22N2/c1-7-11(2)8-9-12(3)13(4,15-6)10-14-5/h7-10,15H,1H2,2-6H3/b11-8-,12-9+,14-10+ |
| InChIKey | MZOXCOPXLZNRNP-XQFKPZNGSA-N |
| XLogP | 2.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|